C24H35ClF2N8OSi — CID 67273345
4-[2-(difluoromethyl)piperazin-1-yl]-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]butanenitrile;hydrochloride (PubChem CID 67273345) has the molecular formula C24H35ClF2N8OSi and a molecular weight of 553.13 g/mol. Its IUPAC name is 4-[2-(difluoromethyl)piperazin-1-yl]-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]butanenitrile;hydrochloride.
| Compound Name | 4-[2-(difluoromethyl)piperazin-1-yl]-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]butanenitrile;hydrochloride |
|---|---|
| PubChem CID | 67273345 |
| Molecular Formula | C24H35ClF2N8OSi |
| Molecular Weight | 553.13 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | 4-[2-(difluoromethyl)piperazin-1-yl]-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]butanenitrile;hydrochloride |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(-c3cnn(C(CC#N)CN4CCNCC4C(F)F)c3)ncnc21.Cl |
| InChI | InChI=1S/C24H34F2N8OSi.ClH/c1-36(2,3)11-10-35-17-33-8-5-20-22(29-16-30-24(20)33)18-12-31-34(14-18)19(4-6-27)15-32-9-7-28-13-21(32)23(25)26;/h5,8,12,14,16,19,21,23,28H,4,7,9-11,13,15,17H2,1-3H3;1H |
| InChIKey | PWAGZYBYNDPFAT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 96.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.13 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|