C34H47N5O3 — CID 67273635
(3R,5S)-5-[benzylcarbamoyl(2-methylpropyl)amino]-N-cyclopropyl-N-[1-(1H-indol-3-yl)-4-methoxybutyl]piperidine-3-carboxamide (PubChem CID 67273635) has the molecular formula C34H47N5O3 and a molecular weight of 573.78 g/mol. Its IUPAC name is (3R,5S)-5-[benzylcarbamoyl(2-methylpropyl)amino]-N-cyclopropyl-N-[1-(1H-indol-3-yl)-4-methoxybutyl]piperidine-3-carboxamide.
| Compound Name | (3R,5S)-5-[benzylcarbamoyl(2-methylpropyl)amino]-N-cyclopropyl-N-[1-(1H-indol-3-yl)-4-methoxybutyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 67273635 |
| Molecular Formula | C34H47N5O3 |
| Molecular Weight | 573.78 g/mol |
| Exact Mass | 573.37 |
| IUPAC Name | (3R,5S)-5-[benzylcarbamoyl(2-methylpropyl)amino]-N-cyclopropyl-N-[1-(1H-indol-3-yl)-4-methoxybutyl]piperidine-3-carboxamide |
| SMILES | COCCCC(c1c[nH]c2ccccc12)N(C(=O)[C@H]1CNC[C@@H](N(CC(C)C)C(=O)NCc2ccccc2)C1)C1CC1 |
| InChI | InChI=1S/C34H47N5O3/c1-24(2)23-38(34(41)37-19-25-10-5-4-6-11-25)28-18-26(20-35-21-28)33(40)39(27-15-16-27)32(14-9-17-42-3)30-22-36-31-13-8-7-12-29(30)31/h4-8,10-13,22,24,26-28,32,35-36H,9,14-21,23H2,1-3H3,(H,37,41)/t26-,28+,32?/m1/s1 |
| InChIKey | VPDSFFFVNPXTME-PAEOOMDFSA-N |
| XLogP | 5.47 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.78 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|