C22H34FN7OSi — CID 67273823
2-[[4-[1-(3-fluoro-2-piperazin-1-ylpropyl)pyrazol-4-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane (PubChem CID 67273823) has the molecular formula C22H34FN7OSi and a molecular weight of 459.65 g/mol. Its IUPAC name is 2-[[4-[1-(3-fluoro-2-piperazin-1-ylpropyl)pyrazol-4-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-[1-(3-fluoro-2-piperazin-1-ylpropyl)pyrazol-4-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 67273823 |
| Molecular Formula | C22H34FN7OSi |
| Molecular Weight | 459.65 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | 2-[[4-[1-(3-fluoro-2-piperazin-1-ylpropyl)pyrazol-4-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(-c3cnn(CC(CF)N4CCNCC4)c3)ncnc21 |
| InChI | InChI=1S/C22H34FN7OSi/c1-32(2,3)11-10-31-17-29-7-4-20-21(25-16-26-22(20)29)18-13-27-30(14-18)15-19(12-23)28-8-5-24-6-9-28/h4,7,13-14,16,19,24H,5-6,8-12,15,17H2,1-3H3 |
| InChIKey | OBONMDNSVLPISV-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 73.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.65 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|