About 4-[3-(2,6-dimethylmorpholin-4-yl)propoxy]-3,5-dimethoxyaniline
4-[3-(2,6-dimethylmorpholin-4-yl)propoxy]-3,5-dimethoxyaniline (PubChem CID 67274115) has the molecular formula C17H28N2O4
and a molecular weight of 324.42 g/mol. Its IUPAC name is 4-[3-(2,6-dimethylmorpholin-4-yl)propoxy]-3,5-dimethoxyaniline.
Molecular Properties
| Compound Name | 4-[3-(2,6-dimethylmorpholin-4-yl)propoxy]-3,5-dimethoxyaniline |
| PubChem CID | 67274115 |
| Molecular Formula | C17H28N2O4 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 4-[3-(2,6-dimethylmorpholin-4-yl)propoxy]-3,5-dimethoxyaniline |
| SMILES | COc1cc(N)cc(OC)c1OCCCN1CC(C)OC(C)C1 |
| InChI | InChI=1S/C17H28N2O4/c1-12-10-19(11-13(2)23-12)6-5-7-22-17-15(20-3)8-14(18)9-16(17)21-4/h8-9,12-13H,5-7,10-11,18H2,1-4H3 |
| InChIKey | PBSZIKUVZMDPPG-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 66.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-(2,6-dimethylmorpholin-4-yl)propoxy]-3,5-dimethoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(2,6-dimethylmorpholin-4-yl)propoxy]-3,5-dimethoxyaniline?
The IUPAC name of 4-[3-(2,6-dimethylmorpholin-4-yl)propoxy]-3,5-dimethoxyaniline (CID 67274115) is 4-[3-(2,6-dimethylmorpholin-4-yl)propoxy]-3,5-dimethoxyaniline.
What is the SMILES notation for 4-[3-(2,6-dimethylmorpholin-4-yl)propoxy]-3,5-dimethoxyaniline?
The canonical SMILES for 4-[3-(2,6-dimethylmorpholin-4-yl)propoxy]-3,5-dimethoxyaniline is COc1cc(N)cc(OC)c1OCCCN1CC(C)OC(C)C1.
What is the InChIKey of 4-[3-(2,6-dimethylmorpholin-4-yl)propoxy]-3,5-dimethoxyaniline?
The InChIKey is PBSZIKUVZMDPPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N2O4/c1-12-10-19(11-13(2)23-12)6-5-7-22-17-15(20-3)8-14(18)9-16(17)21-4/h8-9,12-13H,5-7,10-11,18H2,1-4H3.
What are the key properties of 4-[3-(2,6-dimethylmorpholin-4-yl)propoxy]-3,5-dimethoxyaniline?
4-[3-(2,6-dimethylmorpholin-4-yl)propoxy]-3,5-dimethoxyaniline has a molecular weight of 324.42 g/mol, XLogP of 2.16, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(2,6-dimethylmorpholin-4-yl)propoxy]-3,5-dimethoxyaniline is sourced from PubChem (CID 67274115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).