C8H12N4O3S — CID 67274434
1-(6-amino-4-methylsulfonyl-2-pyridinyl)-3-methylurea (PubChem CID 67274434) has the molecular formula C8H12N4O3S and a molecular weight of 244.28 g/mol. Its IUPAC name is 1-(6-amino-4-methylsulfonyl-2-pyridinyl)-3-methylurea.
| Compound Name | 1-(6-amino-4-methylsulfonyl-2-pyridinyl)-3-methylurea |
|---|---|
| PubChem CID | 67274434 |
| Molecular Formula | C8H12N4O3S |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 1-(6-amino-4-methylsulfonyl-2-pyridinyl)-3-methylurea |
| SMILES | CNC(=O)Nc1cc(S(C)(=O)=O)cc(N)n1 |
| InChI | InChI=1S/C8H12N4O3S/c1-10-8(13)12-7-4-5(16(2,14)15)3-6(9)11-7/h3-4H,1-2H3,(H4,9,10,11,12,13) |
| InChIKey | CITALYMBFSBUFZ-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |