About 6-(4-acetyl-1,4-diazepan-1-yl)-N-[5-(4-methoxyphenyl)-1H-pyrazol-3-yl]hexanamide
6-(4-acetyl-1,4-diazepan-1-yl)-N-[5-(4-methoxyphenyl)-1H-pyrazol-3-yl]hexanamide (PubChem CID 67274463) has the molecular formula C23H33N5O3
and a molecular weight of 427.55 g/mol. Its IUPAC name is 6-(4-acetyl-1,4-diazepan-1-yl)-N-[5-(4-methoxyphenyl)-1H-pyrazol-3-yl]hexanamide.
Molecular Properties
| Compound Name | 6-(4-acetyl-1,4-diazepan-1-yl)-N-[5-(4-methoxyphenyl)-1H-pyrazol-3-yl]hexanamide |
| PubChem CID | 67274463 |
| Molecular Formula | C23H33N5O3 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | 6-(4-acetyl-1,4-diazepan-1-yl)-N-[5-(4-methoxyphenyl)-1H-pyrazol-3-yl]hexanamide |
| SMILES | COc1ccc(-c2cc(NC(=O)CCCCCN3CCCN(C(C)=O)CC3)n[nH]2)cc1 |
| InChI | InChI=1S/C23H33N5O3/c1-18(29)28-14-6-13-27(15-16-28)12-5-3-4-7-23(30)24-22-17-21(25-26-22)19-8-10-20(31-2)11-9-19/h8-11,17H,3-7,12-16H2,1-2H3,(H2,24,25,26,30) |
| InChIKey | UOQVYOAAKMRFAF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 90.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(4-acetyl-1,4-diazepan-1-yl)-N-[5-(4-methoxyphenyl)-1H-pyrazol-3-yl]hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-acetyl-1,4-diazepan-1-yl)-N-[5-(4-methoxyphenyl)-1H-pyrazol-3-yl]hexanamide?
The IUPAC name of 6-(4-acetyl-1,4-diazepan-1-yl)-N-[5-(4-methoxyphenyl)-1H-pyrazol-3-yl]hexanamide (CID 67274463) is 6-(4-acetyl-1,4-diazepan-1-yl)-N-[5-(4-methoxyphenyl)-1H-pyrazol-3-yl]hexanamide.
What is the SMILES notation for 6-(4-acetyl-1,4-diazepan-1-yl)-N-[5-(4-methoxyphenyl)-1H-pyrazol-3-yl]hexanamide?
The canonical SMILES for 6-(4-acetyl-1,4-diazepan-1-yl)-N-[5-(4-methoxyphenyl)-1H-pyrazol-3-yl]hexanamide is COc1ccc(-c2cc(NC(=O)CCCCCN3CCCN(C(C)=O)CC3)n[nH]2)cc1.
What is the InChIKey of 6-(4-acetyl-1,4-diazepan-1-yl)-N-[5-(4-methoxyphenyl)-1H-pyrazol-3-yl]hexanamide?
The InChIKey is UOQVYOAAKMRFAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H33N5O3/c1-18(29)28-14-6-13-27(15-16-28)12-5-3-4-7-23(30)24-22-17-21(25-26-22)19-8-10-20(31-2)11-9-19/h8-11,17H,3-7,12-16H2,1-2H3,(H2,24,25,26,30).
What are the key properties of 6-(4-acetyl-1,4-diazepan-1-yl)-N-[5-(4-methoxyphenyl)-1H-pyrazol-3-yl]hexanamide?
6-(4-acetyl-1,4-diazepan-1-yl)-N-[5-(4-methoxyphenyl)-1H-pyrazol-3-yl]hexanamide has a molecular weight of 427.55 g/mol, XLogP of 3.14, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-acetyl-1,4-diazepan-1-yl)-N-[5-(4-methoxyphenyl)-1H-pyrazol-3-yl]hexanamide is sourced from PubChem (CID 67274463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).