About 3-(methoxymethyl)-2-benzofuran-4,5-dicarbonitrile
3-(methoxymethyl)-2-benzofuran-4,5-dicarbonitrile (PubChem CID 67274548) has the molecular formula C12H8N2O2
and a molecular weight of 212.21 g/mol. Its IUPAC name is 3-(methoxymethyl)-2-benzofuran-4,5-dicarbonitrile.
Molecular Properties
| Compound Name | 3-(methoxymethyl)-2-benzofuran-4,5-dicarbonitrile |
| PubChem CID | 67274548 |
| Molecular Formula | C12H8N2O2 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 3-(methoxymethyl)-2-benzofuran-4,5-dicarbonitrile |
| SMILES | COCc1occ2ccc(C#N)c(C#N)c12 |
| InChI | InChI=1S/C12H8N2O2/c1-15-7-11-12-9(6-16-11)3-2-8(4-13)10(12)5-14/h2-3,6H,7H2,1H3 |
| InChIKey | IZCVDAIGWMXGKN-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 69.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(methoxymethyl)-2-benzofuran-4,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(methoxymethyl)-2-benzofuran-4,5-dicarbonitrile?
The IUPAC name of 3-(methoxymethyl)-2-benzofuran-4,5-dicarbonitrile (CID 67274548) is 3-(methoxymethyl)-2-benzofuran-4,5-dicarbonitrile.
What is the SMILES notation for 3-(methoxymethyl)-2-benzofuran-4,5-dicarbonitrile?
The canonical SMILES for 3-(methoxymethyl)-2-benzofuran-4,5-dicarbonitrile is COCc1occ2ccc(C#N)c(C#N)c12.
What is the InChIKey of 3-(methoxymethyl)-2-benzofuran-4,5-dicarbonitrile?
The InChIKey is IZCVDAIGWMXGKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2O2/c1-15-7-11-12-9(6-16-11)3-2-8(4-13)10(12)5-14/h2-3,6H,7H2,1H3.
What are the key properties of 3-(methoxymethyl)-2-benzofuran-4,5-dicarbonitrile?
3-(methoxymethyl)-2-benzofuran-4,5-dicarbonitrile has a molecular weight of 212.21 g/mol, XLogP of 2.32, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(methoxymethyl)-2-benzofuran-4,5-dicarbonitrile is sourced from PubChem (CID 67274548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).