C18H15Cl3N2O2S — CID 67274905
4-[4-(3,4,5-trichlorophenoxy)piperidin-1-yl]-1,3-benzothiazol-5-ol (PubChem CID 67274905) has the molecular formula C18H15Cl3N2O2S and a molecular weight of 429.76 g/mol. Its IUPAC name is 4-[4-(3,4,5-trichlorophenoxy)piperidin-1-yl]-1,3-benzothiazol-5-ol.
| Compound Name | 4-[4-(3,4,5-trichlorophenoxy)piperidin-1-yl]-1,3-benzothiazol-5-ol |
|---|---|
| PubChem CID | 67274905 |
| Molecular Formula | C18H15Cl3N2O2S |
| Molecular Weight | 429.76 g/mol |
| Exact Mass | 427.99 |
| IUPAC Name | 4-[4-(3,4,5-trichlorophenoxy)piperidin-1-yl]-1,3-benzothiazol-5-ol |
| SMILES | Oc1ccc2scnc2c1N1CCC(Oc2cc(Cl)c(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C18H15Cl3N2O2S/c19-12-7-11(8-13(20)16(12)21)25-10-3-5-23(6-4-10)18-14(24)1-2-15-17(18)22-9-26-15/h1-2,7-10,24H,3-6H2 |
| InChIKey | AIVUTIPMBSWREJ-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.76 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|