C17H26O — CID 67275379
5-(6-methoxyhexyl)-1,2,3,4-tetrahydronaphthalene (PubChem CID 67275379) has the molecular formula C17H26O and a molecular weight of 246.39 g/mol. Its IUPAC name is 5-(6-methoxyhexyl)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 5-(6-methoxyhexyl)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 67275379 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | 5-(6-methoxyhexyl)-1,2,3,4-tetrahydronaphthalene |
| SMILES | COCCCCCCc1cccc2c1CCCC2 |
| InChI | InChI=1S/C17H26O/c1-18-14-7-3-2-4-9-15-11-8-12-16-10-5-6-13-17(15)16/h8,11-12H,2-7,9-10,13-14H2,1H3 |
| InChIKey | JAUIPEBJYMFLHD-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|