About 4-[4-[3-(trifluoromethyl)phenoxy]piperidin-1-yl]-1,3-benzothiazol-7-ol
4-[4-[3-(trifluoromethyl)phenoxy]piperidin-1-yl]-1,3-benzothiazol-7-ol (PubChem CID 67275451) has the molecular formula C19H17F3N2O2S
and a molecular weight of 394.42 g/mol. Its IUPAC name is 4-[4-[3-(trifluoromethyl)phenoxy]piperidin-1-yl]-1,3-benzothiazol-7-ol.
Molecular Properties
| Compound Name | 4-[4-[3-(trifluoromethyl)phenoxy]piperidin-1-yl]-1,3-benzothiazol-7-ol |
| PubChem CID | 67275451 |
| Molecular Formula | C19H17F3N2O2S |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 4-[4-[3-(trifluoromethyl)phenoxy]piperidin-1-yl]-1,3-benzothiazol-7-ol |
| SMILES | Oc1ccc(N2CCC(Oc3cccc(C(F)(F)F)c3)CC2)c2ncsc12 |
| InChI | InChI=1S/C19H17F3N2O2S/c20-19(21,22)12-2-1-3-14(10-12)26-13-6-8-24(9-7-13)15-4-5-16(25)18-17(15)23-11-27-18/h1-5,10-11,13,25H,6-9H2 |
| InChIKey | JTBOBOBUPWIPDK-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[4-[3-(trifluoromethyl)phenoxy]piperidin-1-yl]-1,3-benzothiazol-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[3-(trifluoromethyl)phenoxy]piperidin-1-yl]-1,3-benzothiazol-7-ol?
The IUPAC name of 4-[4-[3-(trifluoromethyl)phenoxy]piperidin-1-yl]-1,3-benzothiazol-7-ol (CID 67275451) is 4-[4-[3-(trifluoromethyl)phenoxy]piperidin-1-yl]-1,3-benzothiazol-7-ol.
What is the SMILES notation for 4-[4-[3-(trifluoromethyl)phenoxy]piperidin-1-yl]-1,3-benzothiazol-7-ol?
The canonical SMILES for 4-[4-[3-(trifluoromethyl)phenoxy]piperidin-1-yl]-1,3-benzothiazol-7-ol is Oc1ccc(N2CCC(Oc3cccc(C(F)(F)F)c3)CC2)c2ncsc12.
What is the InChIKey of 4-[4-[3-(trifluoromethyl)phenoxy]piperidin-1-yl]-1,3-benzothiazol-7-ol?
The InChIKey is JTBOBOBUPWIPDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17F3N2O2S/c20-19(21,22)12-2-1-3-14(10-12)26-13-6-8-24(9-7-13)15-4-5-16(25)18-17(15)23-11-27-18/h1-5,10-11,13,25H,6-9H2.
What are the key properties of 4-[4-[3-(trifluoromethyl)phenoxy]piperidin-1-yl]-1,3-benzothiazol-7-ol?
4-[4-[3-(trifluoromethyl)phenoxy]piperidin-1-yl]-1,3-benzothiazol-7-ol has a molecular weight of 394.42 g/mol, XLogP of 5.07, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[3-(trifluoromethyl)phenoxy]piperidin-1-yl]-1,3-benzothiazol-7-ol is sourced from PubChem (CID 67275451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).