About 4-methyl-1,2,6-triphenoxypiperidine
4-methyl-1,2,6-triphenoxypiperidine (PubChem CID 67275500) has the molecular formula C24H25NO3
and a molecular weight of 375.47 g/mol. Its IUPAC name is 4-methyl-1,2,6-triphenoxypiperidine.
Molecular Properties
| Compound Name | 4-methyl-1,2,6-triphenoxypiperidine |
| PubChem CID | 67275500 |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 4-methyl-1,2,6-triphenoxypiperidine |
| SMILES | CC1CC(Oc2ccccc2)N(Oc2ccccc2)C(Oc2ccccc2)C1 |
| InChI | InChI=1S/C24H25NO3/c1-19-17-23(26-20-11-5-2-6-12-20)25(28-22-15-9-4-10-16-22)24(18-19)27-21-13-7-3-8-14-21/h2-16,19,23-24H,17-18H2,1H3 |
| InChIKey | OEVWTAGRTUWKHZ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methyl-1,2,6-triphenoxypiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1,2,6-triphenoxypiperidine?
The IUPAC name of 4-methyl-1,2,6-triphenoxypiperidine (CID 67275500) is 4-methyl-1,2,6-triphenoxypiperidine.
What is the SMILES notation for 4-methyl-1,2,6-triphenoxypiperidine?
The canonical SMILES for 4-methyl-1,2,6-triphenoxypiperidine is CC1CC(Oc2ccccc2)N(Oc2ccccc2)C(Oc2ccccc2)C1.
What is the InChIKey of 4-methyl-1,2,6-triphenoxypiperidine?
The InChIKey is OEVWTAGRTUWKHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25NO3/c1-19-17-23(26-20-11-5-2-6-12-20)25(28-22-15-9-4-10-16-22)24(18-19)27-21-13-7-3-8-14-21/h2-16,19,23-24H,17-18H2,1H3.
What are the key properties of 4-methyl-1,2,6-triphenoxypiperidine?
4-methyl-1,2,6-triphenoxypiperidine has a molecular weight of 375.47 g/mol, XLogP of 5.52, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1,2,6-triphenoxypiperidine is sourced from PubChem (CID 67275500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).