C27H29F4N5O4 — CID 67275512
N-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]-N-methyl-1-[4-[(2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methoxy]phenyl]piperidin-4-amine (PubChem CID 67275512) has the molecular formula C27H29F4N5O4 and a molecular weight of 563.55 g/mol. Its IUPAC name is N-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]-N-methyl-1-[4-[(2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methoxy]phenyl]piperidin-4-amine.
| Compound Name | N-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]-N-methyl-1-[4-[(2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methoxy]phenyl]piperidin-4-amine |
|---|---|
| PubChem CID | 67275512 |
| Molecular Formula | C27H29F4N5O4 |
| Molecular Weight | 563.55 g/mol |
| Exact Mass | 563.22 |
| IUPAC Name | N-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]-N-methyl-1-[4-[(2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methoxy]phenyl]piperidin-4-amine |
| SMILES | CN(Cc1ccc(C(F)(F)F)cc1F)C1CCN(c2ccc(OCC3(C)Cn4cc([N+](=O)[O-])nc4O3)cc2)CC1 |
| InChI | InChI=1S/C27H29F4N5O4/c1-26(16-35-15-24(36(37)38)32-25(35)40-26)17-39-22-7-5-21(6-8-22)34-11-9-20(10-12-34)33(2)14-18-3-4-19(13-23(18)28)27(29,30)31/h3-8,13,15,20H,9-12,14,16-17H2,1-2H3 |
| InChIKey | SKBHDICFPRAKGR-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 85.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.55 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|