C26H29Cl2F3N4O4 — CID 67275794
6-[(1R,5S)-3-[[2-(2,4-dichlorophenoxy)-2-methylpropanoyl]amino]-8-azabicyclo[3.2.1]octan-8-yl]-N-(3,3,3-trifluoro-2-hydroxypropyl)pyridine-3-carboxamide (PubChem CID 67275794) has the molecular formula C26H29Cl2F3N4O4 and a molecular weight of 589.44 g/mol. Its IUPAC name is 6-[(1R,5S)-3-[[2-(2,4-dichlorophenoxy)-2-methylpropanoyl]amino]-8-azabicyclo[3.2.1]octan-8-yl]-N-(3,3,3-trifluoro-2-hydroxypropyl)pyridine-3-carboxamide.
| Compound Name | 6-[(1R,5S)-3-[[2-(2,4-dichlorophenoxy)-2-methylpropanoyl]amino]-8-azabicyclo[3.2.1]octan-8-yl]-N-(3,3,3-trifluoro-2-hydroxypropyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 67275794 |
| Molecular Formula | C26H29Cl2F3N4O4 |
| Molecular Weight | 589.44 g/mol |
| Exact Mass | 588.15 |
| IUPAC Name | 6-[(1R,5S)-3-[[2-(2,4-dichlorophenoxy)-2-methylpropanoyl]amino]-8-azabicyclo[3.2.1]octan-8-yl]-N-(3,3,3-trifluoro-2-hydroxypropyl)pyridine-3-carboxamide |
| SMILES | CC(C)(Oc1ccc(Cl)cc1Cl)C(=O)NC1C[C@H]2CC[C@@H](C1)N2c1ccc(C(=O)NCC(O)C(F)(F)F)cn1 |
| InChI | InChI=1S/C26H29Cl2F3N4O4/c1-25(2,39-20-7-4-15(27)9-19(20)28)24(38)34-16-10-17-5-6-18(11-16)35(17)22-8-3-14(12-32-22)23(37)33-13-21(36)26(29,30)31/h3-4,7-9,12,16-18,21,36H,5-6,10-11,13H2,1-2H3,(H,33,37)(H,34,38)/t16?,17-,18+,21? |
| InChIKey | RCOBTRSEGBWPTO-TZKKQGAMSA-N |
| XLogP | 4.51 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.44 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |