C24H24Cl2N3O6PS — CID 67276131
3-[(3,5-dichlorophenyl)sulfonyl-[2-(5-methyl-1,2,4-oxadiazol-3-yl)naphthalen-1-yl]amino]pentan-3-ylphosphonic acid (PubChem CID 67276131) has the molecular formula C24H24Cl2N3O6PS and a molecular weight of 584.42 g/mol. Its IUPAC name is 3-[(3,5-dichlorophenyl)sulfonyl-[2-(5-methyl-1,2,4-oxadiazol-3-yl)naphthalen-1-yl]amino]pentan-3-ylphosphonic acid.
| Compound Name | 3-[(3,5-dichlorophenyl)sulfonyl-[2-(5-methyl-1,2,4-oxadiazol-3-yl)naphthalen-1-yl]amino]pentan-3-ylphosphonic acid |
|---|---|
| PubChem CID | 67276131 |
| Molecular Formula | C24H24Cl2N3O6PS |
| Molecular Weight | 584.42 g/mol |
| Exact Mass | 583.05 |
| IUPAC Name | 3-[(3,5-dichlorophenyl)sulfonyl-[2-(5-methyl-1,2,4-oxadiazol-3-yl)naphthalen-1-yl]amino]pentan-3-ylphosphonic acid |
| SMILES | CCC(CC)(N(c1c(-c2noc(C)n2)ccc2ccccc12)S(=O)(=O)c1cc(Cl)cc(Cl)c1)P(=O)(O)O |
| InChI | InChI=1S/C24H24Cl2N3O6PS/c1-4-24(5-2,36(30,31)32)29(37(33,34)19-13-17(25)12-18(26)14-19)22-20-9-7-6-8-16(20)10-11-21(22)23-27-15(3)35-28-23/h6-14H,4-5H2,1-3H3,(H2,30,31,32) |
| InChIKey | UOJIOGJDRAPTKU-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.42 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|