About 3-[(3,5-dichlorophenyl)sulfonyl-(2-methylquinolin-8-yl)amino]pentan-3-ylphosphonic acid
3-[(3,5-dichlorophenyl)sulfonyl-(2-methylquinolin-8-yl)amino]pentan-3-ylphosphonic acid (PubChem CID 67276334) has the molecular formula C21H23Cl2N2O5PS
and a molecular weight of 517.37 g/mol. Its IUPAC name is 3-[(3,5-dichlorophenyl)sulfonyl-(2-methylquinolin-8-yl)amino]pentan-3-ylphosphonic acid.
Molecular Properties
| Compound Name | 3-[(3,5-dichlorophenyl)sulfonyl-(2-methylquinolin-8-yl)amino]pentan-3-ylphosphonic acid |
| PubChem CID | 67276334 |
| Molecular Formula | C21H23Cl2N2O5PS |
| Molecular Weight | 517.37 g/mol |
| Exact Mass | 516.04 |
| IUPAC Name | 3-[(3,5-dichlorophenyl)sulfonyl-(2-methylquinolin-8-yl)amino]pentan-3-ylphosphonic acid |
| SMILES | CCC(CC)(N(c1cccc2ccc(C)nc12)S(=O)(=O)c1cc(Cl)cc(Cl)c1)P(=O)(O)O |
| InChI | InChI=1S/C21H23Cl2N2O5PS/c1-4-21(5-2,31(26,27)28)25(32(29,30)18-12-16(22)11-17(23)13-18)19-8-6-7-15-10-9-14(3)24-20(15)19/h6-13H,4-5H2,1-3H3,(H2,26,27,28) |
| InChIKey | OUFPENAUIMYOMO-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 107.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 517.37 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3,5-dichlorophenyl)sulfonyl-(2-methylquinolin-8-yl)amino]pentan-3-ylphosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3,5-dichlorophenyl)sulfonyl-(2-methylquinolin-8-yl)amino]pentan-3-ylphosphonic acid?
The IUPAC name of 3-[(3,5-dichlorophenyl)sulfonyl-(2-methylquinolin-8-yl)amino]pentan-3-ylphosphonic acid (CID 67276334) is 3-[(3,5-dichlorophenyl)sulfonyl-(2-methylquinolin-8-yl)amino]pentan-3-ylphosphonic acid.
What is the SMILES notation for 3-[(3,5-dichlorophenyl)sulfonyl-(2-methylquinolin-8-yl)amino]pentan-3-ylphosphonic acid?
The canonical SMILES for 3-[(3,5-dichlorophenyl)sulfonyl-(2-methylquinolin-8-yl)amino]pentan-3-ylphosphonic acid is CCC(CC)(N(c1cccc2ccc(C)nc12)S(=O)(=O)c1cc(Cl)cc(Cl)c1)P(=O)(O)O.
What is the InChIKey of 3-[(3,5-dichlorophenyl)sulfonyl-(2-methylquinolin-8-yl)amino]pentan-3-ylphosphonic acid?
The InChIKey is OUFPENAUIMYOMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23Cl2N2O5PS/c1-4-21(5-2,31(26,27)28)25(32(29,30)18-12-16(22)11-17(23)13-18)19-8-6-7-15-10-9-14(3)24-20(15)19/h6-13H,4-5H2,1-3H3,(H2,26,27,28).
What are the key properties of 3-[(3,5-dichlorophenyl)sulfonyl-(2-methylquinolin-8-yl)amino]pentan-3-ylphosphonic acid?
3-[(3,5-dichlorophenyl)sulfonyl-(2-methylquinolin-8-yl)amino]pentan-3-ylphosphonic acid has a molecular weight of 517.37 g/mol, XLogP of 5.74, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,5-dichlorophenyl)sulfonyl-(2-methylquinolin-8-yl)amino]pentan-3-ylphosphonic acid is sourced from PubChem (CID 67276334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).