C18H22N2O2 — CID 67276883
4-[(1-benzylimidazol-4-yl)methyl]heptane-3,5-dione (PubChem CID 67276883) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 4-[(1-benzylimidazol-4-yl)methyl]heptane-3,5-dione.
| Compound Name | 4-[(1-benzylimidazol-4-yl)methyl]heptane-3,5-dione |
|---|---|
| PubChem CID | 67276883 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 4-[(1-benzylimidazol-4-yl)methyl]heptane-3,5-dione |
| SMILES | CCC(=O)C(Cc1cn(Cc2ccccc2)cn1)C(=O)CC |
| InChI | InChI=1S/C18H22N2O2/c1-3-17(21)16(18(22)4-2)10-15-12-20(13-19-15)11-14-8-6-5-7-9-14/h5-9,12-13,16H,3-4,10-11H2,1-2H3 |
| InChIKey | JRKUICHAJMOUNB-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|