C24H28O4 — CID 67277107
2,2-bis(3-phenylpropanoyl)hexanoic acid (PubChem CID 67277107) has the molecular formula C24H28O4 and a molecular weight of 380.48 g/mol. Its IUPAC name is 2,2-bis(3-phenylpropanoyl)hexanoic acid.
| Compound Name | 2,2-bis(3-phenylpropanoyl)hexanoic acid |
|---|---|
| PubChem CID | 67277107 |
| Molecular Formula | C24H28O4 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 2,2-bis(3-phenylpropanoyl)hexanoic acid |
| SMILES | CCCCC(C(=O)O)(C(=O)CCc1ccccc1)C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C24H28O4/c1-2-3-18-24(23(27)28,21(25)16-14-19-10-6-4-7-11-19)22(26)17-15-20-12-8-5-9-13-20/h4-13H,2-3,14-18H2,1H3,(H,27,28) |
| InChIKey | KXCUJBRUDKFBGG-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|