C17H16N8O3 — CID 67277168
3-[(3R)-1-(5-nitropyrimidin-2-yl)piperidin-3-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one (PubChem CID 67277168) has the molecular formula C17H16N8O3 and a molecular weight of 380.37 g/mol. Its IUPAC name is 3-[(3R)-1-(5-nitropyrimidin-2-yl)piperidin-3-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one.
| Compound Name | 3-[(3R)-1-(5-nitropyrimidin-2-yl)piperidin-3-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one |
|---|---|
| PubChem CID | 67277168 |
| Molecular Formula | C17H16N8O3 |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 3-[(3R)-1-(5-nitropyrimidin-2-yl)piperidin-3-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one |
| SMILES | O=c1[nH]c2cnc3[nH]ccc3c2n1[C@@H]1CCCN(c2ncc([N+](=O)[O-])cn2)C1 |
| InChI | InChI=1S/C17H16N8O3/c26-17-22-13-8-19-15-12(3-4-18-15)14(13)24(17)10-2-1-5-23(9-10)16-20-6-11(7-21-16)25(27)28/h3-4,6-8,10H,1-2,5,9H2,(H,18,19)(H,22,26)/t10-/m1/s1 |
| InChIKey | JOEFFUXDNYRLMQ-SNVBAGLBSA-N |
| XLogP | 1.75 |
| TPSA | 138.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|