C15H24N2O4S — CID 67277826
4-(benzenesulfonyl)-2,6-bis(methoxymethyl)-1-methylpiperazine (PubChem CID 67277826) has the molecular formula C15H24N2O4S and a molecular weight of 328.43 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-2,6-bis(methoxymethyl)-1-methylpiperazine.
| Compound Name | 4-(benzenesulfonyl)-2,6-bis(methoxymethyl)-1-methylpiperazine |
|---|---|
| PubChem CID | 67277826 |
| Molecular Formula | C15H24N2O4S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 4-(benzenesulfonyl)-2,6-bis(methoxymethyl)-1-methylpiperazine |
| SMILES | COCC1CN(S(=O)(=O)c2ccccc2)CC(COC)N1C |
| InChI | InChI=1S/C15H24N2O4S/c1-16-13(11-20-2)9-17(10-14(16)12-21-3)22(18,19)15-7-5-4-6-8-15/h4-8,13-14H,9-12H2,1-3H3 |
| InChIKey | RIZVXRYYMFMKRE-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |