C13H14N4O2 — CID 67278165
3-(oxan-4-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one (PubChem CID 67278165) has the molecular formula C13H14N4O2 and a molecular weight of 258.28 g/mol. Its IUPAC name is 3-(oxan-4-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one.
| Compound Name | 3-(oxan-4-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one |
|---|---|
| PubChem CID | 67278165 |
| Molecular Formula | C13H14N4O2 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 3-(oxan-4-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one |
| SMILES | O=c1[nH]c2cnc3[nH]ccc3c2n1C1CCOCC1 |
| InChI | InChI=1S/C13H14N4O2/c18-13-16-10-7-15-12-9(1-4-14-12)11(10)17(13)8-2-5-19-6-3-8/h1,4,7-8H,2-3,5-6H2,(H,14,15)(H,16,18) |
| InChIKey | LPBWTDDVBDMMKT-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 75.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |