C24H22FN2O6S- — CID 67278234
5-[[5-(carboxymethoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]-sulfinatoamino]-2-(5-fluoro-2-methoxyphenyl)pyridine (PubChem CID 67278234) has the molecular formula C24H22FN2O6S- and a molecular weight of 485.51 g/mol. Its IUPAC name is 5-[[5-(carboxymethoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]-sulfinatoamino]-2-(5-fluoro-2-methoxyphenyl)pyridine.
| Compound Name | 5-[[5-(carboxymethoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]-sulfinatoamino]-2-(5-fluoro-2-methoxyphenyl)pyridine |
|---|---|
| PubChem CID | 67278234 |
| Molecular Formula | C24H22FN2O6S- |
| Molecular Weight | 485.51 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | 5-[[5-(carboxymethoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]-sulfinatoamino]-2-(5-fluoro-2-methoxyphenyl)pyridine |
| SMILES | COc1ccc(F)cc1-c1ccc(N(C2CCCc3c(OCC(=O)O)cccc32)S(=O)[O-])cn1 |
| InChI | InChI=1S/C24H23FN2O6S/c1-32-22-11-8-15(25)12-19(22)20-10-9-16(13-26-20)27(34(30)31)21-6-2-5-18-17(21)4-3-7-23(18)33-14-24(28)29/h3-4,7-13,21H,2,5-6,14H2,1H3,(H,28,29)(H,30,31)/p-1 |
| InChIKey | FLWJMGONNVFZFD-UHFFFAOYSA-M |
| XLogP | 4.04 |
| TPSA | 112.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.51 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|