C19H17F3N6O — CID 67278364
3-[(3R)-1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one (PubChem CID 67278364) has the molecular formula C19H17F3N6O and a molecular weight of 402.38 g/mol. Its IUPAC name is 3-[(3R)-1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one.
| Compound Name | 3-[(3R)-1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one |
|---|---|
| PubChem CID | 67278364 |
| Molecular Formula | C19H17F3N6O |
| Molecular Weight | 402.38 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 3-[(3R)-1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one |
| SMILES | O=c1[nH]c2cnc3[nH]ccc3c2n1[C@@H]1CCCN(c2ccc(C(F)(F)F)cn2)C1 |
| InChI | InChI=1S/C19H17F3N6O/c20-19(21,22)11-3-4-15(24-8-11)27-7-1-2-12(10-27)28-16-13-5-6-23-17(13)25-9-14(16)26-18(28)29/h3-6,8-9,12H,1-2,7,10H2,(H,23,25)(H,26,29)/t12-/m1/s1 |
| InChIKey | JASYMFNOOVYBMO-GFCCVEGCSA-N |
| XLogP | 3.46 |
| TPSA | 82.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |