C14H9ClF3NO3 — CID 67278416
3-[(2,3,6-trifluorobenzoyl)amino]benzoic acid;hydrochloride (PubChem CID 67278416) has the molecular formula C14H9ClF3NO3 and a molecular weight of 331.68 g/mol. Its IUPAC name is 3-[(2,3,6-trifluorobenzoyl)amino]benzoic acid;hydrochloride.
| Compound Name | 3-[(2,3,6-trifluorobenzoyl)amino]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 67278416 |
| Molecular Formula | C14H9ClF3NO3 |
| Molecular Weight | 331.68 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 3-[(2,3,6-trifluorobenzoyl)amino]benzoic acid;hydrochloride |
| SMILES | Cl.O=C(O)c1cccc(NC(=O)c2c(F)ccc(F)c2F)c1 |
| InChI | InChI=1S/C14H8F3NO3.ClH/c15-9-4-5-10(16)12(17)11(9)13(19)18-8-3-1-2-7(6-8)14(20)21;/h1-6H,(H,18,19)(H,20,21);1H |
| InChIKey | YSGWCKGHUYYYTP-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.68 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|