C18H17N7O3 — CID 67278696
3-[(3R)-1-(3-nitro-2-pyridinyl)piperidin-3-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one (PubChem CID 67278696) has the molecular formula C18H17N7O3 and a molecular weight of 379.38 g/mol. Its IUPAC name is 3-[(3R)-1-(3-nitro-2-pyridinyl)piperidin-3-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one.
| Compound Name | 3-[(3R)-1-(3-nitro-2-pyridinyl)piperidin-3-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one |
|---|---|
| PubChem CID | 67278696 |
| Molecular Formula | C18H17N7O3 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 3-[(3R)-1-(3-nitro-2-pyridinyl)piperidin-3-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one |
| SMILES | O=c1[nH]c2cnc3[nH]ccc3c2n1[C@@H]1CCCN(c2ncccc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C18H17N7O3/c26-18-22-13-9-21-16-12(5-7-19-16)15(13)24(18)11-3-2-8-23(10-11)17-14(25(27)28)4-1-6-20-17/h1,4-7,9,11H,2-3,8,10H2,(H,19,21)(H,22,26)/t11-/m1/s1 |
| InChIKey | AKJCNZSQEYUURR-LLVKDONJSA-N |
| XLogP | 2.35 |
| TPSA | 125.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|