C24H20F3N2O5S- — CID 67278737
5-[[5-(carboxymethoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]-sulfinatoamino]-2-[3-(trifluoromethyl)phenyl]pyridine (PubChem CID 67278737) has the molecular formula C24H20F3N2O5S- and a molecular weight of 505.49 g/mol. Its IUPAC name is 5-[[5-(carboxymethoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]-sulfinatoamino]-2-[3-(trifluoromethyl)phenyl]pyridine.
| Compound Name | 5-[[5-(carboxymethoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]-sulfinatoamino]-2-[3-(trifluoromethyl)phenyl]pyridine |
|---|---|
| PubChem CID | 67278737 |
| Molecular Formula | C24H20F3N2O5S- |
| Molecular Weight | 505.49 g/mol |
| Exact Mass | 505.11 |
| IUPAC Name | 5-[[5-(carboxymethoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]-sulfinatoamino]-2-[3-(trifluoromethyl)phenyl]pyridine |
| SMILES | O=C(O)COc1cccc2c1CCCC2N(c1ccc(-c2cccc(C(F)(F)F)c2)nc1)S(=O)[O-] |
| InChI | InChI=1S/C24H21F3N2O5S/c25-24(26,27)16-5-1-4-15(12-16)20-11-10-17(13-28-20)29(35(32)33)21-8-2-7-19-18(21)6-3-9-22(19)34-14-23(30)31/h1,3-6,9-13,21H,2,7-8,14H2,(H,30,31)(H,32,33)/p-1 |
| InChIKey | UQABTFJLXYGZTI-UHFFFAOYSA-M |
| XLogP | 4.91 |
| TPSA | 102.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.49 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|