C9H13NO — CID 67278756
2,3,4,4a,6,8a-hexahydro-1H-quinolin-5-one (PubChem CID 67278756) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is 2,3,4,4a,6,8a-hexahydro-1H-quinolin-5-one.
| Compound Name | 2,3,4,4a,6,8a-hexahydro-1H-quinolin-5-one |
|---|---|
| PubChem CID | 67278756 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 2,3,4,4a,6,8a-hexahydro-1H-quinolin-5-one |
| SMILES | O=C1CC=CC2NCCCC12 |
| InChI | InChI=1S/C9H13NO/c11-9-5-1-4-8-7(9)3-2-6-10-8/h1,4,7-8,10H,2-3,5-6H2 |
| InChIKey | CXYLZVDXHHXSAZ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|