C19H25F2N3O3S — CID 67278768
[(4aS,5S,8aS)-8a-(5-amino-2-fluorophenyl)-5-(fluoromethyl)-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-2-yl]-tert-butylcarbamic acid (PubChem CID 67278768) has the molecular formula C19H25F2N3O3S and a molecular weight of 413.49 g/mol. Its IUPAC name is [(4aS,5S,8aS)-8a-(5-amino-2-fluorophenyl)-5-(fluoromethyl)-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-2-yl]-tert-butylcarbamic acid.
| Compound Name | [(4aS,5S,8aS)-8a-(5-amino-2-fluorophenyl)-5-(fluoromethyl)-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-2-yl]-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 67278768 |
| Molecular Formula | C19H25F2N3O3S |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | [(4aS,5S,8aS)-8a-(5-amino-2-fluorophenyl)-5-(fluoromethyl)-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-2-yl]-tert-butylcarbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)C1=N[C@@]2(c3cc(N)ccc3F)CCO[C@H](CF)[C@H]2CS1 |
| InChI | InChI=1S/C19H25F2N3O3S/c1-18(2,3)24(17(25)26)16-23-19(12-8-11(22)4-5-14(12)21)6-7-27-15(9-20)13(19)10-28-16/h4-5,8,13,15H,6-7,9-10,22H2,1-3H3,(H,25,26)/t13-,15-,19-/m1/s1 |
| InChIKey | LRBVPKCNYXREDN-ZXYWRSMDSA-N |
| XLogP | 3.86 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|