About 4,5-diamino-3H-1,3-thiazol-2-one
4,5-diamino-3H-1,3-thiazol-2-one (PubChem CID 67278795) has the molecular formula C3H5N3OS
and a molecular weight of 131.16 g/mol. Its IUPAC name is 4,5-diamino-3H-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | 4,5-diamino-3H-1,3-thiazol-2-one |
| PubChem CID | 67278795 |
| Molecular Formula | C3H5N3OS |
| Molecular Weight | 131.16 g/mol |
| Exact Mass | 131.02 |
| IUPAC Name | 4,5-diamino-3H-1,3-thiazol-2-one |
| SMILES | Nc1[nH]c(=O)sc1N |
| InChI | InChI=1S/C3H5N3OS/c4-1-2(5)8-3(7)6-1/h4-5H2,(H,6,7) |
| InChIKey | MADPVGDBYIBTPH-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 84.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.16 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,5-diamino-3H-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-diamino-3H-1,3-thiazol-2-one?
The IUPAC name of 4,5-diamino-3H-1,3-thiazol-2-one (CID 67278795) is 4,5-diamino-3H-1,3-thiazol-2-one.
What is the SMILES notation for 4,5-diamino-3H-1,3-thiazol-2-one?
The canonical SMILES for 4,5-diamino-3H-1,3-thiazol-2-one is Nc1[nH]c(=O)sc1N.
What is the InChIKey of 4,5-diamino-3H-1,3-thiazol-2-one?
The InChIKey is MADPVGDBYIBTPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5N3OS/c4-1-2(5)8-3(7)6-1/h4-5H2,(H,6,7).
What are the key properties of 4,5-diamino-3H-1,3-thiazol-2-one?
4,5-diamino-3H-1,3-thiazol-2-one has a molecular weight of 131.16 g/mol, XLogP of -0.40, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-diamino-3H-1,3-thiazol-2-one is sourced from PubChem (CID 67278795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).