C17H22FN3O3S — CID 67278831
[(4aS,7aS)-7a-(5-amino-2-fluorophenyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]-tert-butylcarbamic acid (PubChem CID 67278831) has the molecular formula C17H22FN3O3S and a molecular weight of 367.45 g/mol. Its IUPAC name is [(4aS,7aS)-7a-(5-amino-2-fluorophenyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]-tert-butylcarbamic acid.
| Compound Name | [(4aS,7aS)-7a-(5-amino-2-fluorophenyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 67278831 |
| Molecular Formula | C17H22FN3O3S |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | [(4aS,7aS)-7a-(5-amino-2-fluorophenyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]-tert-butylcarbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)C1=N[C@@]2(c3cc(N)ccc3F)COC[C@H]2CS1 |
| InChI | InChI=1S/C17H22FN3O3S/c1-16(2,3)21(15(22)23)14-20-17(9-24-7-10(17)8-25-14)12-6-11(19)4-5-13(12)18/h4-6,10H,7-9,19H2,1-3H3,(H,22,23)/t10-,17-/m0/s1 |
| InChIKey | AQEZZUSHSJICIQ-BTDLBPIBSA-N |
| XLogP | 3.13 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|