About propanediamide;thieno[3,2-d]pyrimidine
propanediamide;thieno[3,2-d]pyrimidine (PubChem CID 67279021) has the molecular formula C9H10N4O2S
and a molecular weight of 238.27 g/mol. Its IUPAC name is propanediamide;thieno[3,2-d]pyrimidine.
Molecular Properties
| Compound Name | propanediamide;thieno[3,2-d]pyrimidine |
| PubChem CID | 67279021 |
| Molecular Formula | C9H10N4O2S |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | propanediamide;thieno[3,2-d]pyrimidine |
| SMILES | NC(=O)CC(N)=O.c1ncc2sccc2n1 |
| InChI | InChI=1S/C6H4N2S.C3H6N2O2/c1-2-9-6-3-7-4-8-5(1)6;4-2(6)1-3(5)7/h1-4H;1H2,(H2,4,6)(H2,5,7) |
| InChIKey | QXBHNNGOFAKSMB-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze propanediamide;thieno[3,2-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propanediamide;thieno[3,2-d]pyrimidine?
The IUPAC name of propanediamide;thieno[3,2-d]pyrimidine (CID 67279021) is propanediamide;thieno[3,2-d]pyrimidine.
What is the SMILES notation for propanediamide;thieno[3,2-d]pyrimidine?
The canonical SMILES for propanediamide;thieno[3,2-d]pyrimidine is NC(=O)CC(N)=O.c1ncc2sccc2n1.
What is the InChIKey of propanediamide;thieno[3,2-d]pyrimidine?
The InChIKey is QXBHNNGOFAKSMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2S.C3H6N2O2/c1-2-9-6-3-7-4-8-5(1)6;4-2(6)1-3(5)7/h1-4H;1H2,(H2,4,6)(H2,5,7).
What are the key properties of propanediamide;thieno[3,2-d]pyrimidine?
propanediamide;thieno[3,2-d]pyrimidine has a molecular weight of 238.27 g/mol, XLogP of 0.04, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propanediamide;thieno[3,2-d]pyrimidine is sourced from PubChem (CID 67279021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).