C19H26FN3O3S — CID 67279295
[(4aS,5S,7aS)-7a-(5-amino-2-fluorophenyl)-5-methoxy-4a,5,6,7-tetrahydro-4H-cyclopenta[d][1,3]thiazin-2-yl]-tert-butylcarbamic acid (PubChem CID 67279295) has the molecular formula C19H26FN3O3S and a molecular weight of 395.50 g/mol. Its IUPAC name is [(4aS,5S,7aS)-7a-(5-amino-2-fluorophenyl)-5-methoxy-4a,5,6,7-tetrahydro-4H-cyclopenta[d][1,3]thiazin-2-yl]-tert-butylcarbamic acid.
| Compound Name | [(4aS,5S,7aS)-7a-(5-amino-2-fluorophenyl)-5-methoxy-4a,5,6,7-tetrahydro-4H-cyclopenta[d][1,3]thiazin-2-yl]-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 67279295 |
| Molecular Formula | C19H26FN3O3S |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | [(4aS,5S,7aS)-7a-(5-amino-2-fluorophenyl)-5-methoxy-4a,5,6,7-tetrahydro-4H-cyclopenta[d][1,3]thiazin-2-yl]-tert-butylcarbamic acid |
| SMILES | CO[C@H]1CC[C@]2(c3cc(N)ccc3F)N=C(N(C(=O)O)C(C)(C)C)SC[C@H]12 |
| InChI | InChI=1S/C19H26FN3O3S/c1-18(2,3)23(17(24)25)16-22-19(12-9-11(21)5-6-14(12)20)8-7-15(26-4)13(19)10-27-16/h5-6,9,13,15H,7-8,10,21H2,1-4H3,(H,24,25)/t13-,15+,19-/m1/s1 |
| InChIKey | RLTKEXAKCGCPQT-FRIZHTMISA-N |
| XLogP | 3.91 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|