C19H19F3N4O2S — CID 67279380
N-[3-[(4aS,5S,7aS)-2-amino-5-(difluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-7a-yl]-4-fluorophenyl]-1,2-dihydropyridine-5-carboxamide (PubChem CID 67279380) has the molecular formula C19H19F3N4O2S and a molecular weight of 424.45 g/mol. Its IUPAC name is N-[3-[(4aS,5S,7aS)-2-amino-5-(difluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-7a-yl]-4-fluorophenyl]-1,2-dihydropyridine-5-carboxamide.
| Compound Name | N-[3-[(4aS,5S,7aS)-2-amino-5-(difluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-7a-yl]-4-fluorophenyl]-1,2-dihydropyridine-5-carboxamide |
|---|---|
| PubChem CID | 67279380 |
| Molecular Formula | C19H19F3N4O2S |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | N-[3-[(4aS,5S,7aS)-2-amino-5-(difluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-7a-yl]-4-fluorophenyl]-1,2-dihydropyridine-5-carboxamide |
| SMILES | NC1=N[C@@]2(c3cc(NC(=O)C4=CNCC=C4)ccc3F)CO[C@H](C(F)F)[C@H]2CS1 |
| InChI | InChI=1S/C19H19F3N4O2S/c20-14-4-3-11(25-17(27)10-2-1-5-24-7-10)6-12(14)19-9-28-15(16(21)22)13(19)8-29-18(23)26-19/h1-4,6-7,13,15-16,24H,5,8-9H2,(H2,23,26)(H,25,27)/t13-,15+,19-/m1/s1 |
| InChIKey | OXCJFKBXXISRJI-FRIZHTMISA-N |
| XLogP | 2.34 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |