C18H24FN3O3S — CID 67279551
[(4aS,8aR)-8a-(5-amino-2-fluorophenyl)-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-2-yl]-tert-butylcarbamic acid (PubChem CID 67279551) has the molecular formula C18H24FN3O3S and a molecular weight of 381.47 g/mol. Its IUPAC name is [(4aS,8aR)-8a-(5-amino-2-fluorophenyl)-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-2-yl]-tert-butylcarbamic acid.
| Compound Name | [(4aS,8aR)-8a-(5-amino-2-fluorophenyl)-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-2-yl]-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 67279551 |
| Molecular Formula | C18H24FN3O3S |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | [(4aS,8aR)-8a-(5-amino-2-fluorophenyl)-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-2-yl]-tert-butylcarbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)C1=N[C@]2(c3cc(N)ccc3F)CCOC[C@H]2CS1 |
| InChI | InChI=1S/C18H24FN3O3S/c1-17(2,3)22(16(23)24)15-21-18(6-7-25-9-11(18)10-26-15)13-8-12(20)4-5-14(13)19/h4-5,8,11H,6-7,9-10,20H2,1-3H3,(H,23,24)/t11-,18+/m0/s1 |
| InChIKey | QDFIGLBIPCJFLX-BBATYDOGSA-N |
| XLogP | 3.52 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|