About ethenyl but-3-enoate;pyrrolidin-2-one
ethenyl but-3-enoate;pyrrolidin-2-one (PubChem CID 67279694) has the molecular formula C10H15NO3
and a molecular weight of 197.23 g/mol. Its IUPAC name is ethenyl but-3-enoate;pyrrolidin-2-one.
Molecular Properties
| Compound Name | ethenyl but-3-enoate;pyrrolidin-2-one |
| PubChem CID | 67279694 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | ethenyl but-3-enoate;pyrrolidin-2-one |
| SMILES | C=CCC(=O)OC=C.O=C1CCCN1 |
| InChI | InChI=1S/C6H8O2.C4H7NO/c1-3-5-6(7)8-4-2;6-4-2-1-3-5-4/h3-4H,1-2,5H2;1-3H2,(H,5,6) |
| InChIKey | PJKZMRVKRVDNIV-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethenyl but-3-enoate;pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl but-3-enoate;pyrrolidin-2-one?
The IUPAC name of ethenyl but-3-enoate;pyrrolidin-2-one (CID 67279694) is ethenyl but-3-enoate;pyrrolidin-2-one.
What is the SMILES notation for ethenyl but-3-enoate;pyrrolidin-2-one?
The canonical SMILES for ethenyl but-3-enoate;pyrrolidin-2-one is C=CCC(=O)OC=C.O=C1CCCN1.
What is the InChIKey of ethenyl but-3-enoate;pyrrolidin-2-one?
The InChIKey is PJKZMRVKRVDNIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O2.C4H7NO/c1-3-5-6(7)8-4-2;6-4-2-1-3-5-4/h3-4H,1-2,5H2;1-3H2,(H,5,6).
What are the key properties of ethenyl but-3-enoate;pyrrolidin-2-one?
ethenyl but-3-enoate;pyrrolidin-2-one has a molecular weight of 197.23 g/mol, XLogP of 1.15, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl but-3-enoate;pyrrolidin-2-one is sourced from PubChem (CID 67279694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).