C18H23F2N3O2S — CID 67279726
[(4aR,6R,7aS)-7a-(5-amino-2-fluorophenyl)-6-fluoro-4a,5,6,7-tetrahydro-4H-cyclopenta[d][1,3]thiazin-2-yl]-tert-butylcarbamic acid (PubChem CID 67279726) has the molecular formula C18H23F2N3O2S and a molecular weight of 383.46 g/mol. Its IUPAC name is [(4aR,6R,7aS)-7a-(5-amino-2-fluorophenyl)-6-fluoro-4a,5,6,7-tetrahydro-4H-cyclopenta[d][1,3]thiazin-2-yl]-tert-butylcarbamic acid.
| Compound Name | [(4aR,6R,7aS)-7a-(5-amino-2-fluorophenyl)-6-fluoro-4a,5,6,7-tetrahydro-4H-cyclopenta[d][1,3]thiazin-2-yl]-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 67279726 |
| Molecular Formula | C18H23F2N3O2S |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | [(4aR,6R,7aS)-7a-(5-amino-2-fluorophenyl)-6-fluoro-4a,5,6,7-tetrahydro-4H-cyclopenta[d][1,3]thiazin-2-yl]-tert-butylcarbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)C1=N[C@@]2(c3cc(N)ccc3F)C[C@H](F)C[C@H]2CS1 |
| InChI | InChI=1S/C18H23F2N3O2S/c1-17(2,3)23(16(24)25)15-22-18(8-11(19)6-10(18)9-26-15)13-7-12(21)4-5-14(13)20/h4-5,7,10-11H,6,8-9,21H2,1-3H3,(H,24,25)/t10-,11+,18-/m0/s1 |
| InChIKey | CIKITJPHKDDNPQ-PISHQANHSA-N |
| XLogP | 4.23 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|