About 1-(chloromethyl)-3-fluoro-2,4-dimethylbenzene
1-(chloromethyl)-3-fluoro-2,4-dimethylbenzene (PubChem CID 67280015) has the molecular formula C9H10ClF
and a molecular weight of 172.63 g/mol. Its IUPAC name is 1-(chloromethyl)-3-fluoro-2,4-dimethylbenzene.
Molecular Properties
| Compound Name | 1-(chloromethyl)-3-fluoro-2,4-dimethylbenzene |
| PubChem CID | 67280015 |
| Molecular Formula | C9H10ClF |
| Molecular Weight | 172.63 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | 1-(chloromethyl)-3-fluoro-2,4-dimethylbenzene |
| SMILES | Cc1ccc(CCl)c(C)c1F |
| InChI | InChI=1S/C9H10ClF/c1-6-3-4-8(5-10)7(2)9(6)11/h3-4H,5H2,1-2H3 |
| InChIKey | KHWCOJVQNOXCIJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.63 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(chloromethyl)-3-fluoro-2,4-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(chloromethyl)-3-fluoro-2,4-dimethylbenzene?
The IUPAC name of 1-(chloromethyl)-3-fluoro-2,4-dimethylbenzene (CID 67280015) is 1-(chloromethyl)-3-fluoro-2,4-dimethylbenzene.
What is the SMILES notation for 1-(chloromethyl)-3-fluoro-2,4-dimethylbenzene?
The canonical SMILES for 1-(chloromethyl)-3-fluoro-2,4-dimethylbenzene is Cc1ccc(CCl)c(C)c1F.
What is the InChIKey of 1-(chloromethyl)-3-fluoro-2,4-dimethylbenzene?
The InChIKey is KHWCOJVQNOXCIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClF/c1-6-3-4-8(5-10)7(2)9(6)11/h3-4H,5H2,1-2H3.
What are the key properties of 1-(chloromethyl)-3-fluoro-2,4-dimethylbenzene?
1-(chloromethyl)-3-fluoro-2,4-dimethylbenzene has a molecular weight of 172.63 g/mol, XLogP of 3.18, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(chloromethyl)-3-fluoro-2,4-dimethylbenzene is sourced from PubChem (CID 67280015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).