C14H18N2O7 — CID 67280080
6-(2,5-dioxopyrrol-1-yl)hexanoic acid;1-hydroxypyrrolidine-2,5-dione (PubChem CID 67280080) has the molecular formula C14H18N2O7 and a molecular weight of 326.31 g/mol. Its IUPAC name is 6-(2,5-dioxopyrrol-1-yl)hexanoic acid;1-hydroxypyrrolidine-2,5-dione.
| Compound Name | 6-(2,5-dioxopyrrol-1-yl)hexanoic acid;1-hydroxypyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 67280080 |
| Molecular Formula | C14H18N2O7 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 6-(2,5-dioxopyrrol-1-yl)hexanoic acid;1-hydroxypyrrolidine-2,5-dione |
| SMILES | O=C(O)CCCCCN1C(=O)C=CC1=O.O=C1CCC(=O)N1O |
| InChI | InChI=1S/C10H13NO4.C4H5NO3/c12-8-5-6-9(13)11(8)7-3-1-2-4-10(14)15;6-3-1-2-4(7)5(3)8/h5-6H,1-4,7H2,(H,14,15);8H,1-2H2 |
| InChIKey | HBEDKBRARKFPIC-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 132.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|