C17H27N3O5 — CID 67280253
butanedioic acid;(2S)-N,2-dimethyl-N-propan-2-yl-2,3,4,5-tetrahydropyrido[3,2-f][1,4]oxazepin-8-amine (PubChem CID 67280253) has the molecular formula C17H27N3O5 and a molecular weight of 353.42 g/mol. Its IUPAC name is butanedioic acid;(2S)-N,2-dimethyl-N-propan-2-yl-2,3,4,5-tetrahydropyrido[3,2-f][1,4]oxazepin-8-amine.
| Compound Name | butanedioic acid;(2S)-N,2-dimethyl-N-propan-2-yl-2,3,4,5-tetrahydropyrido[3,2-f][1,4]oxazepin-8-amine |
|---|---|
| PubChem CID | 67280253 |
| Molecular Formula | C17H27N3O5 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | butanedioic acid;(2S)-N,2-dimethyl-N-propan-2-yl-2,3,4,5-tetrahydropyrido[3,2-f][1,4]oxazepin-8-amine |
| SMILES | CC(C)N(C)c1ccc2c(n1)O[C@@H](C)CNC2.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C13H21N3O.C4H6O4/c1-9(2)16(4)12-6-5-11-8-14-7-10(3)17-13(11)15-12;5-3(6)1-2-4(7)8/h5-6,9-10,14H,7-8H2,1-4H3;1-2H2,(H,5,6)(H,7,8)/t10-;/m0./s1 |
| InChIKey | KTFVPTRPWZZCAR-PPHPATTJSA-N |
| XLogP | 1.73 |
| TPSA | 111.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |