C25H29FN4O5 — CID 67280376
[(3R,4S)-4-[(4-fluorobenzoyl)amino]-6-[4-(oxetan-3-yl)piperazin-1-yl]-3,4-dihydro-2H-chromen-3-yl]methylcarbamic acid (PubChem CID 67280376) has the molecular formula C25H29FN4O5 and a molecular weight of 484.53 g/mol. Its IUPAC name is [(3R,4S)-4-[(4-fluorobenzoyl)amino]-6-[4-(oxetan-3-yl)piperazin-1-yl]-3,4-dihydro-2H-chromen-3-yl]methylcarbamic acid.
| Compound Name | [(3R,4S)-4-[(4-fluorobenzoyl)amino]-6-[4-(oxetan-3-yl)piperazin-1-yl]-3,4-dihydro-2H-chromen-3-yl]methylcarbamic acid |
|---|---|
| PubChem CID | 67280376 |
| Molecular Formula | C25H29FN4O5 |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | [(3R,4S)-4-[(4-fluorobenzoyl)amino]-6-[4-(oxetan-3-yl)piperazin-1-yl]-3,4-dihydro-2H-chromen-3-yl]methylcarbamic acid |
| SMILES | O=C(O)NC[C@H]1COc2ccc(N3CCN(C4COC4)CC3)cc2[C@H]1NC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H29FN4O5/c26-18-3-1-16(2-4-18)24(31)28-23-17(12-27-25(32)33)13-35-22-6-5-19(11-21(22)23)29-7-9-30(10-8-29)20-14-34-15-20/h1-6,11,17,20,23,27H,7-10,12-15H2,(H,28,31)(H,32,33)/t17-,23-/m0/s1 |
| InChIKey | OXPPSDAWRDTXRU-SBUREZEXSA-N |
| XLogP | 2.09 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|