C16H21Cl2N5 — CID 67280661
2-N-(2,3-dichlorophenyl)-5-[4-(dimethylamino)butyl]pyrimidine-2,4-diamine (PubChem CID 67280661) has the molecular formula C16H21Cl2N5 and a molecular weight of 354.29 g/mol. Its IUPAC name is 2-N-(2,3-dichlorophenyl)-5-[4-(dimethylamino)butyl]pyrimidine-2,4-diamine.
| Compound Name | 2-N-(2,3-dichlorophenyl)-5-[4-(dimethylamino)butyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 67280661 |
| Molecular Formula | C16H21Cl2N5 |
| Molecular Weight | 354.29 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 2-N-(2,3-dichlorophenyl)-5-[4-(dimethylamino)butyl]pyrimidine-2,4-diamine |
| SMILES | CN(C)CCCCc1cnc(Nc2cccc(Cl)c2Cl)nc1N |
| InChI | InChI=1S/C16H21Cl2N5/c1-23(2)9-4-3-6-11-10-20-16(22-15(11)19)21-13-8-5-7-12(17)14(13)18/h5,7-8,10H,3-4,6,9H2,1-2H3,(H3,19,20,21,22) |
| InChIKey | AACNGLZWGOMWKP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.29 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|