C19H24N4O2 — CID 67280947
[1-phenyl-3-(4-pyridin-2-ylpiperazin-1-yl)propyl] carbamate (PubChem CID 67280947) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is [1-phenyl-3-(4-pyridin-2-ylpiperazin-1-yl)propyl] carbamate.
| Compound Name | [1-phenyl-3-(4-pyridin-2-ylpiperazin-1-yl)propyl] carbamate |
|---|---|
| PubChem CID | 67280947 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | [1-phenyl-3-(4-pyridin-2-ylpiperazin-1-yl)propyl] carbamate |
| SMILES | NC(=O)OC(CCN1CCN(c2ccccn2)CC1)c1ccccc1 |
| InChI | InChI=1S/C19H24N4O2/c20-19(24)25-17(16-6-2-1-3-7-16)9-11-22-12-14-23(15-13-22)18-8-4-5-10-21-18/h1-8,10,17H,9,11-15H2,(H2,20,24) |
| InChIKey | MXHHMSOYGOLVRZ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |