About methyl 7'-oxo-2'-phenylmethoxyspiro[cyclohexane-4,5'-furo[3,4-b]pyridine]-1-carboxylate
methyl 7'-oxo-2'-phenylmethoxyspiro[cyclohexane-4,5'-furo[3,4-b]pyridine]-1-carboxylate (PubChem CID 67281097) has the molecular formula C21H21NO5
and a molecular weight of 367.40 g/mol. Its IUPAC name is methyl 7'-oxo-2'-phenylmethoxyspiro[cyclohexane-4,5'-furo[3,4-b]pyridine]-1-carboxylate.
Molecular Properties
| Compound Name | methyl 7'-oxo-2'-phenylmethoxyspiro[cyclohexane-4,5'-furo[3,4-b]pyridine]-1-carboxylate |
| PubChem CID | 67281097 |
| Molecular Formula | C21H21NO5 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | methyl 7'-oxo-2'-phenylmethoxyspiro[cyclohexane-4,5'-furo[3,4-b]pyridine]-1-carboxylate |
| SMILES | COC(=O)C1CCC2(CC1)OC(=O)c1nc(OCc3ccccc3)ccc12 |
| InChI | InChI=1S/C21H21NO5/c1-25-19(23)15-9-11-21(12-10-15)16-7-8-17(22-18(16)20(24)27-21)26-13-14-5-3-2-4-6-14/h2-8,15H,9-13H2,1H3 |
| InChIKey | QCYGASIUGCCSIT-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 7'-oxo-2'-phenylmethoxyspiro[cyclohexane-4,5'-furo[3,4-b]pyridine]-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7'-oxo-2'-phenylmethoxyspiro[cyclohexane-4,5'-furo[3,4-b]pyridine]-1-carboxylate?
The IUPAC name of methyl 7'-oxo-2'-phenylmethoxyspiro[cyclohexane-4,5'-furo[3,4-b]pyridine]-1-carboxylate (CID 67281097) is methyl 7'-oxo-2'-phenylmethoxyspiro[cyclohexane-4,5'-furo[3,4-b]pyridine]-1-carboxylate.
What is the SMILES notation for methyl 7'-oxo-2'-phenylmethoxyspiro[cyclohexane-4,5'-furo[3,4-b]pyridine]-1-carboxylate?
The canonical SMILES for methyl 7'-oxo-2'-phenylmethoxyspiro[cyclohexane-4,5'-furo[3,4-b]pyridine]-1-carboxylate is COC(=O)C1CCC2(CC1)OC(=O)c1nc(OCc3ccccc3)ccc12.
What is the InChIKey of methyl 7'-oxo-2'-phenylmethoxyspiro[cyclohexane-4,5'-furo[3,4-b]pyridine]-1-carboxylate?
The InChIKey is QCYGASIUGCCSIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21NO5/c1-25-19(23)15-9-11-21(12-10-15)16-7-8-17(22-18(16)20(24)27-21)26-13-14-5-3-2-4-6-14/h2-8,15H,9-13H2,1H3.
What are the key properties of methyl 7'-oxo-2'-phenylmethoxyspiro[cyclohexane-4,5'-furo[3,4-b]pyridine]-1-carboxylate?
methyl 7'-oxo-2'-phenylmethoxyspiro[cyclohexane-4,5'-furo[3,4-b]pyridine]-1-carboxylate has a molecular weight of 367.40 g/mol, XLogP of 3.39, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7'-oxo-2'-phenylmethoxyspiro[cyclohexane-4,5'-furo[3,4-b]pyridine]-1-carboxylate is sourced from PubChem (CID 67281097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).