C9H18N2S — CID 67281104
(4S,5R)-3-butyl-4,5-dimethyl-1,3-thiazolidin-2-imine (PubChem CID 67281104) has the molecular formula C9H18N2S and a molecular weight of 186.32 g/mol. Its IUPAC name is (4S,5R)-3-butyl-4,5-dimethyl-1,3-thiazolidin-2-imine.
| Compound Name | (4S,5R)-3-butyl-4,5-dimethyl-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 67281104 |
| Molecular Formula | C9H18N2S |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | (4S,5R)-3-butyl-4,5-dimethyl-1,3-thiazolidin-2-imine |
| SMILES | [H]/N=C1\S[C@H](C)[C@H](C)N1CCCC |
| InChI | InChI=1S/C9H18N2S/c1-4-5-6-11-7(2)8(3)12-9(11)10/h7-8,10H,4-6H2,1-3H3/b10-9-/t7-,8+/m0/s1 |
| InChIKey | ZYJVMHVQCGRHBT-UFPBWDQISA-N |
| XLogP | 2.55 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|