About 7'-oxo-2'-phenylmethoxyspiro[cyclohexane-4,5'-furo[3,4-b]pyridine]-1-carboxylic acid
7'-oxo-2'-phenylmethoxyspiro[cyclohexane-4,5'-furo[3,4-b]pyridine]-1-carboxylic acid (PubChem CID 67281186) has the molecular formula C20H19NO5
and a molecular weight of 353.37 g/mol. Its IUPAC name is 7'-oxo-2'-phenylmethoxyspiro[cyclohexane-4,5'-furo[3,4-b]pyridine]-1-carboxylic acid.
Molecular Properties
| Compound Name | 7'-oxo-2'-phenylmethoxyspiro[cyclohexane-4,5'-furo[3,4-b]pyridine]-1-carboxylic acid |
| PubChem CID | 67281186 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 7'-oxo-2'-phenylmethoxyspiro[cyclohexane-4,5'-furo[3,4-b]pyridine]-1-carboxylic acid |
| SMILES | O=C1OC2(CCC(C(=O)O)CC2)c2ccc(OCc3ccccc3)nc21 |
| InChI | InChI=1S/C20H19NO5/c22-18(23)14-8-10-20(11-9-14)15-6-7-16(21-17(15)19(24)26-20)25-12-13-4-2-1-3-5-13/h1-7,14H,8-12H2,(H,22,23) |
| InChIKey | OSMRHRRPCUTRQT-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7'-oxo-2'-phenylmethoxyspiro[cyclohexane-4,5'-furo[3,4-b]pyridine]-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7'-oxo-2'-phenylmethoxyspiro[cyclohexane-4,5'-furo[3,4-b]pyridine]-1-carboxylic acid?
The IUPAC name of 7'-oxo-2'-phenylmethoxyspiro[cyclohexane-4,5'-furo[3,4-b]pyridine]-1-carboxylic acid (CID 67281186) is 7'-oxo-2'-phenylmethoxyspiro[cyclohexane-4,5'-furo[3,4-b]pyridine]-1-carboxylic acid.
What is the SMILES notation for 7'-oxo-2'-phenylmethoxyspiro[cyclohexane-4,5'-furo[3,4-b]pyridine]-1-carboxylic acid?
The canonical SMILES for 7'-oxo-2'-phenylmethoxyspiro[cyclohexane-4,5'-furo[3,4-b]pyridine]-1-carboxylic acid is O=C1OC2(CCC(C(=O)O)CC2)c2ccc(OCc3ccccc3)nc21.
What is the InChIKey of 7'-oxo-2'-phenylmethoxyspiro[cyclohexane-4,5'-furo[3,4-b]pyridine]-1-carboxylic acid?
The InChIKey is OSMRHRRPCUTRQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19NO5/c22-18(23)14-8-10-20(11-9-14)15-6-7-16(21-17(15)19(24)26-20)25-12-13-4-2-1-3-5-13/h1-7,14H,8-12H2,(H,22,23).
What are the key properties of 7'-oxo-2'-phenylmethoxyspiro[cyclohexane-4,5'-furo[3,4-b]pyridine]-1-carboxylic acid?
7'-oxo-2'-phenylmethoxyspiro[cyclohexane-4,5'-furo[3,4-b]pyridine]-1-carboxylic acid has a molecular weight of 353.37 g/mol, XLogP of 3.30, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7'-oxo-2'-phenylmethoxyspiro[cyclohexane-4,5'-furo[3,4-b]pyridine]-1-carboxylic acid is sourced from PubChem (CID 67281186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).