About 2-[7-(2-methoxyphenyl)-1,4-oxazepan-4-yl]-3-methyl-6-pyrimidin-4-ylpyrimidin-4-one
2-[7-(2-methoxyphenyl)-1,4-oxazepan-4-yl]-3-methyl-6-pyrimidin-4-ylpyrimidin-4-one (PubChem CID 67281261) has the molecular formula C21H23N5O3
and a molecular weight of 393.45 g/mol. Its IUPAC name is 2-[7-(2-methoxyphenyl)-1,4-oxazepan-4-yl]-3-methyl-6-pyrimidin-4-ylpyrimidin-4-one.
Molecular Properties
| Compound Name | 2-[7-(2-methoxyphenyl)-1,4-oxazepan-4-yl]-3-methyl-6-pyrimidin-4-ylpyrimidin-4-one |
| PubChem CID | 67281261 |
| Molecular Formula | C21H23N5O3 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 2-[7-(2-methoxyphenyl)-1,4-oxazepan-4-yl]-3-methyl-6-pyrimidin-4-ylpyrimidin-4-one |
| SMILES | COc1ccccc1C1CCN(c2nc(-c3ccncn3)cc(=O)n2C)CCO1 |
| InChI | InChI=1S/C21H23N5O3/c1-25-20(27)13-17(16-7-9-22-14-23-16)24-21(25)26-10-8-19(29-12-11-26)15-5-3-4-6-18(15)28-2/h3-7,9,13-14,19H,8,10-12H2,1-2H3 |
| InChIKey | XXMJGBWPZJIGJE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 82.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-[7-(2-methoxyphenyl)-1,4-oxazepan-4-yl]-3-methyl-6-pyrimidin-4-ylpyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[7-(2-methoxyphenyl)-1,4-oxazepan-4-yl]-3-methyl-6-pyrimidin-4-ylpyrimidin-4-one?
The IUPAC name of 2-[7-(2-methoxyphenyl)-1,4-oxazepan-4-yl]-3-methyl-6-pyrimidin-4-ylpyrimidin-4-one (CID 67281261) is 2-[7-(2-methoxyphenyl)-1,4-oxazepan-4-yl]-3-methyl-6-pyrimidin-4-ylpyrimidin-4-one.
What is the SMILES notation for 2-[7-(2-methoxyphenyl)-1,4-oxazepan-4-yl]-3-methyl-6-pyrimidin-4-ylpyrimidin-4-one?
The canonical SMILES for 2-[7-(2-methoxyphenyl)-1,4-oxazepan-4-yl]-3-methyl-6-pyrimidin-4-ylpyrimidin-4-one is COc1ccccc1C1CCN(c2nc(-c3ccncn3)cc(=O)n2C)CCO1.
What is the InChIKey of 2-[7-(2-methoxyphenyl)-1,4-oxazepan-4-yl]-3-methyl-6-pyrimidin-4-ylpyrimidin-4-one?
The InChIKey is XXMJGBWPZJIGJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N5O3/c1-25-20(27)13-17(16-7-9-22-14-23-16)24-21(25)26-10-8-19(29-12-11-26)15-5-3-4-6-18(15)28-2/h3-7,9,13-14,19H,8,10-12H2,1-2H3.
What are the key properties of 2-[7-(2-methoxyphenyl)-1,4-oxazepan-4-yl]-3-methyl-6-pyrimidin-4-ylpyrimidin-4-one?
2-[7-(2-methoxyphenyl)-1,4-oxazepan-4-yl]-3-methyl-6-pyrimidin-4-ylpyrimidin-4-one has a molecular weight of 393.45 g/mol, XLogP of 2.21, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[7-(2-methoxyphenyl)-1,4-oxazepan-4-yl]-3-methyl-6-pyrimidin-4-ylpyrimidin-4-one is sourced from PubChem (CID 67281261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).