C25H26N4NaO3S — CID 67281332
CID 67281332 (PubChem CID 67281332) has the molecular formula C25H26N4NaO3S and a molecular weight of 485.57 g/mol.
| Compound Name | CID 67281332 |
|---|---|
| PubChem CID | 67281332 |
| Molecular Formula | C25H26N4NaO3S |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | — |
| SMILES | Cc1c(-c2nnc(-c3ccc(OC(C)C)c(C#N)c3)s2)ccc2c1CCN(CCC(=O)O)C2.[Na] |
| InChI | InChI=1S/C25H26N4O3S.Na/c1-15(2)32-22-7-5-17(12-19(22)13-26)24-27-28-25(33-24)21-6-4-18-14-29(11-9-23(30)31)10-8-20(18)16(21)3;/h4-7,12,15H,8-11,14H2,1-3H3,(H,30,31); |
| InChIKey | XMLJSGYSPULVDI-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |