About 3-methyl-2-(5-methyl-1,4-oxazepan-4-yl)-6-pyrimidin-4-ylpyrimidin-4-one
3-methyl-2-(5-methyl-1,4-oxazepan-4-yl)-6-pyrimidin-4-ylpyrimidin-4-one (PubChem CID 67281369) has the molecular formula C15H19N5O2
and a molecular weight of 301.35 g/mol. Its IUPAC name is 3-methyl-2-(5-methyl-1,4-oxazepan-4-yl)-6-pyrimidin-4-ylpyrimidin-4-one.
Molecular Properties
| Compound Name | 3-methyl-2-(5-methyl-1,4-oxazepan-4-yl)-6-pyrimidin-4-ylpyrimidin-4-one |
| PubChem CID | 67281369 |
| Molecular Formula | C15H19N5O2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 3-methyl-2-(5-methyl-1,4-oxazepan-4-yl)-6-pyrimidin-4-ylpyrimidin-4-one |
| SMILES | CC1CCOCCN1c1nc(-c2ccncn2)cc(=O)n1C |
| InChI | InChI=1S/C15H19N5O2/c1-11-4-7-22-8-6-20(11)15-18-13(9-14(21)19(15)2)12-3-5-16-10-17-12/h3,5,9-11H,4,6-8H2,1-2H3 |
| InChIKey | LLRRJOGBGMHZKS-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-methyl-2-(5-methyl-1,4-oxazepan-4-yl)-6-pyrimidin-4-ylpyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2-(5-methyl-1,4-oxazepan-4-yl)-6-pyrimidin-4-ylpyrimidin-4-one?
The IUPAC name of 3-methyl-2-(5-methyl-1,4-oxazepan-4-yl)-6-pyrimidin-4-ylpyrimidin-4-one (CID 67281369) is 3-methyl-2-(5-methyl-1,4-oxazepan-4-yl)-6-pyrimidin-4-ylpyrimidin-4-one.
What is the SMILES notation for 3-methyl-2-(5-methyl-1,4-oxazepan-4-yl)-6-pyrimidin-4-ylpyrimidin-4-one?
The canonical SMILES for 3-methyl-2-(5-methyl-1,4-oxazepan-4-yl)-6-pyrimidin-4-ylpyrimidin-4-one is CC1CCOCCN1c1nc(-c2ccncn2)cc(=O)n1C.
What is the InChIKey of 3-methyl-2-(5-methyl-1,4-oxazepan-4-yl)-6-pyrimidin-4-ylpyrimidin-4-one?
The InChIKey is LLRRJOGBGMHZKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N5O2/c1-11-4-7-22-8-6-20(11)15-18-13(9-14(21)19(15)2)12-3-5-16-10-17-12/h3,5,9-11H,4,6-8H2,1-2H3.
What are the key properties of 3-methyl-2-(5-methyl-1,4-oxazepan-4-yl)-6-pyrimidin-4-ylpyrimidin-4-one?
3-methyl-2-(5-methyl-1,4-oxazepan-4-yl)-6-pyrimidin-4-ylpyrimidin-4-one has a molecular weight of 301.35 g/mol, XLogP of 0.85, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-(5-methyl-1,4-oxazepan-4-yl)-6-pyrimidin-4-ylpyrimidin-4-one is sourced from PubChem (CID 67281369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).