C19H13ClFN3O2 — CID 67281501
2-[1-[(2-chloro-6-fluorophenyl)methyl]-5-methylpyrazol-3-yl]isoindole-1,3-dione (PubChem CID 67281501) has the molecular formula C19H13ClFN3O2 and a molecular weight of 369.78 g/mol. Its IUPAC name is 2-[1-[(2-chloro-6-fluorophenyl)methyl]-5-methylpyrazol-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[1-[(2-chloro-6-fluorophenyl)methyl]-5-methylpyrazol-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 67281501 |
| Molecular Formula | C19H13ClFN3O2 |
| Molecular Weight | 369.78 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | 2-[1-[(2-chloro-6-fluorophenyl)methyl]-5-methylpyrazol-3-yl]isoindole-1,3-dione |
| SMILES | Cc1cc(N2C(=O)c3ccccc3C2=O)nn1Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C19H13ClFN3O2/c1-11-9-17(22-23(11)10-14-15(20)7-4-8-16(14)21)24-18(25)12-5-2-3-6-13(12)19(24)26/h2-9H,10H2,1H3 |
| InChIKey | MESMDLIRVPZKLS-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.78 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|