C14H20N2O3 — CID 67281529
[(1S,2S)-6-amino-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-tert-butylcarbamic acid (PubChem CID 67281529) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is [(1S,2S)-6-amino-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-tert-butylcarbamic acid.
| Compound Name | [(1S,2S)-6-amino-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 67281529 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | [(1S,2S)-6-amino-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-tert-butylcarbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)[C@H]1c2cc(N)ccc2C[C@@H]1O |
| InChI | InChI=1S/C14H20N2O3/c1-14(2,3)16(13(18)19)12-10-7-9(15)5-4-8(10)6-11(12)17/h4-5,7,11-12,17H,6,15H2,1-3H3,(H,18,19)/t11-,12-/m0/s1 |
| InChIKey | SRLOVDWMCNQVKZ-RYUDHWBXSA-N |
| XLogP | 2.01 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|