C31H36ClN5O4 — CID 67281648
N-(3-chloro-4-methoxyphenyl)-3-[[4-[3-(diethylamino)propylcarbamoyl]-3,5-dimethyl-1H-pyrrol-2-yl]methylidene]-2-oxo-1H-indole-4-carboxamide (PubChem CID 67281648) has the molecular formula C31H36ClN5O4 and a molecular weight of 578.11 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-3-[[4-[3-(diethylamino)propylcarbamoyl]-3,5-dimethyl-1H-pyrrol-2-yl]methylidene]-2-oxo-1H-indole-4-carboxamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-3-[[4-[3-(diethylamino)propylcarbamoyl]-3,5-dimethyl-1H-pyrrol-2-yl]methylidene]-2-oxo-1H-indole-4-carboxamide |
|---|---|
| PubChem CID | 67281648 |
| Molecular Formula | C31H36ClN5O4 |
| Molecular Weight | 578.11 g/mol |
| Exact Mass | 577.25 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-3-[[4-[3-(diethylamino)propylcarbamoyl]-3,5-dimethyl-1H-pyrrol-2-yl]methylidene]-2-oxo-1H-indole-4-carboxamide |
| SMILES | CCN(CC)CCCNC(=O)c1c(C)[nH]c(C=C2C(=O)Nc3cccc(C(=O)Nc4ccc(OC)c(Cl)c4)c32)c1C |
| InChI | InChI=1S/C31H36ClN5O4/c1-6-37(7-2)15-9-14-33-31(40)27-18(3)25(34-19(27)4)17-22-28-21(10-8-11-24(28)36-30(22)39)29(38)35-20-12-13-26(41-5)23(32)16-20/h8,10-13,16-17,34H,6-7,9,14-15H2,1-5H3,(H,33,40)(H,35,38)(H,36,39) |
| InChIKey | GIJZIOXYMDSSIK-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.11 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|